C10H13Br2Cl3HgN2O3S — CID 70521973
[3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanyl-bromomercury;hydrobromide (PubChem CID 70521973) has the molecular formula C10H13Br2Cl3HgN2O3S and a molecular weight of 708.05 g/mol. Its IUPAC name is [3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanyl-bromomercury;hydrobromide.
| Compound Name | [3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanyl-bromomercury;hydrobromide |
|---|---|
| PubChem CID | 70521973 |
| Molecular Formula | C10H13Br2Cl3HgN2O3S |
| Molecular Weight | 708.05 g/mol |
| Exact Mass | 705.78 |
| IUPAC Name | [3-amino-1-[3-methyl-1-oxo-1-(2,2,2-trichloroethoxy)but-3-en-2-yl]-4-oxoazetidin-2-yl]sulfanyl-bromomercury;hydrobromide |
| SMILES | Br.C=C(C)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C(N)C1S[Hg]Br |
| InChI | InChI=1S/C10H13Cl3N2O3S.2BrH.Hg/c1-4(2)6(9(17)18-3-10(11,12)13)15-7(16)5(14)8(15)19;;;/h5-6,8,19H,1,3,14H2,2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | HICKUCFCWBYWAD-UHFFFAOYSA-L |
| XLogP | 2.96 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.05 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|