About 2-chloro-4-ethylazete
2-chloro-4-ethylazete (PubChem CID 70522004) has the molecular formula C5H6ClN
and a molecular weight of 115.56 g/mol. Its IUPAC name is 2-chloro-4-ethylazete.
Molecular Properties
| Compound Name | 2-chloro-4-ethylazete |
| PubChem CID | 70522004 |
| Molecular Formula | C5H6ClN |
| Molecular Weight | 115.56 g/mol |
| Exact Mass | 115.02 |
| IUPAC Name | 2-chloro-4-ethylazete |
| SMILES | CCC1=NC(Cl)=C1 |
| InChI | InChI=1S/C5H6ClN/c1-2-4-3-5(6)7-4/h3H,2H2,1H3 |
| InChIKey | XFHQMCONXBYNMU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.56 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-ethylazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-ethylazete?
The IUPAC name of 2-chloro-4-ethylazete (CID 70522004) is 2-chloro-4-ethylazete.
What is the SMILES notation for 2-chloro-4-ethylazete?
The canonical SMILES for 2-chloro-4-ethylazete is CCC1=NC(Cl)=C1.
What is the InChIKey of 2-chloro-4-ethylazete?
The InChIKey is XFHQMCONXBYNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClN/c1-2-4-3-5(6)7-4/h3H,2H2,1H3.
What are the key properties of 2-chloro-4-ethylazete?
2-chloro-4-ethylazete has a molecular weight of 115.56 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-ethylazete is sourced from PubChem (CID 70522004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).