C9H16N2 — CID 70522582
1,2,4,5,6-pentamethyl-2H-pyrimidine (PubChem CID 70522582) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,2,4,5,6-pentamethyl-2H-pyrimidine.
| Compound Name | 1,2,4,5,6-pentamethyl-2H-pyrimidine |
|---|---|
| PubChem CID | 70522582 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,2,4,5,6-pentamethyl-2H-pyrimidine |
| SMILES | CC1=NC(C)N(C)C(C)=C1C |
| InChI | InChI=1S/C9H16N2/c1-6-7(2)10-9(4)11(5)8(6)3/h9H,1-5H3 |
| InChIKey | BPIWDZXBQKLOJR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |