C20H28O8 — CID 7052269
(1R,8R,13S,20R)-3,6,15,18-tetraoxatricyclo[18.4.0.08,13]tetracosane-2,7,14,19-tetrone (PubChem CID 7052269) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is (1R,8R,13S,20R)-3,6,15,18-tetraoxatricyclo[18.4.0.08,13]tetracosane-2,7,14,19-tetrone.
| Compound Name | (1R,8R,13S,20R)-3,6,15,18-tetraoxatricyclo[18.4.0.08,13]tetracosane-2,7,14,19-tetrone |
|---|---|
| PubChem CID | 7052269 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1R,8R,13S,20R)-3,6,15,18-tetraoxatricyclo[18.4.0.08,13]tetracosane-2,7,14,19-tetrone |
| SMILES | O=C1OCCOC(=O)[C@@H]2CCCC[C@H]2C(=O)OCCOC(=O)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C20H28O8/c21-17-13-5-1-2-6-14(13)18(22)26-11-12-28-20(24)16-8-4-3-7-15(16)19(23)27-10-9-25-17/h13-16H,1-12H2/t13-,14-,15-,16+/m1/s1 |
| InChIKey | ZXACQVCGGIZLKQ-FPCVCCKLSA-N |
| XLogP | 1.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|