C34H68N6O2 — CID 70522704
1-[6-[diethylcarbamoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-3,3-diethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 70522704) has the molecular formula C34H68N6O2 and a molecular weight of 592.96 g/mol. Its IUPAC name is 1-[6-[diethylcarbamoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-3,3-diethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-[6-[diethylcarbamoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-3,3-diethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 70522704 |
| Molecular Formula | C34H68N6O2 |
| Molecular Weight | 592.96 g/mol |
| Exact Mass | 592.54 |
| IUPAC Name | 1-[6-[diethylcarbamoyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-3,3-diethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CCN(CC)C(=O)N(CCCCCCN(C(=O)N(CC)CC)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C34H68N6O2/c1-13-37(14-2)29(41)39(27-23-31(5,6)35-32(7,8)24-27)21-19-17-18-20-22-40(30(42)38(15-3)16-4)28-25-33(9,10)36-34(11,12)26-28/h27-28,35-36H,13-26H2,1-12H3 |
| InChIKey | TWVARHPXRXJAHQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.96 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|