About 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine
2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine (PubChem CID 70522982) has the molecular formula C21H39NS
and a molecular weight of 337.62 g/mol. Its IUPAC name is 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine.
Molecular Properties
| Compound Name | 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine |
| PubChem CID | 70522982 |
| Molecular Formula | C21H39NS |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine |
| SMILES | C=CCC1C(N)CC(CCCCC)SC1(CC=C)CCCCC |
| InChI | InChI=1S/C21H39NS/c1-5-9-11-14-18-17-20(22)19(13-7-3)21(23-18,15-8-4)16-12-10-6-2/h7-8,18-20H,3-6,9-17,22H2,1-2H3 |
| InChIKey | QDBRIBCIDGBCNC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine?
The IUPAC name of 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine (CID 70522982) is 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine.
What is the SMILES notation for 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine?
The canonical SMILES for 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine is C=CCC1C(N)CC(CCCCC)SC1(CC=C)CCCCC.
What is the InChIKey of 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine?
The InChIKey is QDBRIBCIDGBCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39NS/c1-5-9-11-14-18-17-20(22)19(13-7-3)21(23-18,15-8-4)16-12-10-6-2/h7-8,18-20H,3-6,9-17,22H2,1-2H3.
What are the key properties of 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine?
2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine has a molecular weight of 337.62 g/mol, XLogP of 6.49, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dipentyl-2,3-bis(prop-2-enyl)thian-4-amine is sourced from PubChem (CID 70522982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).