C16H22OS2 — CID 70523007
1,3,4,6-tetrakis(prop-2-enyl)-7-oxa-2,5-dithiabicyclo[2.2.1]heptane (PubChem CID 70523007) has the molecular formula C16H22OS2 and a molecular weight of 294.49 g/mol. Its IUPAC name is 1,3,4,6-tetrakis(prop-2-enyl)-7-oxa-2,5-dithiabicyclo[2.2.1]heptane.
| Compound Name | 1,3,4,6-tetrakis(prop-2-enyl)-7-oxa-2,5-dithiabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 70523007 |
| Molecular Formula | C16H22OS2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1,3,4,6-tetrakis(prop-2-enyl)-7-oxa-2,5-dithiabicyclo[2.2.1]heptane |
| SMILES | C=CCC1SC2(CC=C)OC1(CC=C)SC2CC=C |
| InChI | InChI=1S/C16H22OS2/c1-5-9-13-15(11-7-3)17-16(18-13,12-8-4)14(19-15)10-6-2/h5-8,13-14H,1-4,9-12H2 |
| InChIKey | POGNBHPRSVDLAV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|