About (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene
(4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene (PubChem CID 70523119) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene.
Molecular Properties
| Compound Name | (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene |
| PubChem CID | 70523119 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.CC(C)(C)c1ccc(CO)cc1-c1ncccn1 |
| InChI | InChI=1S/C15H18N2O.C6H10O/c1-15(2,3)13-6-5-11(10-18)9-12(13)14-16-7-4-8-17-14;1-3-5-7-6-4-2/h4-9,18H,10H2,1-3H3;3-4H,1-2,5-6H2 |
| InChIKey | PWOSZDKTRWVQKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene?
The IUPAC name of (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene (CID 70523119) is (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene.
What is the SMILES notation for (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene?
The canonical SMILES for (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene is C=CCOCC=C.CC(C)(C)c1ccc(CO)cc1-c1ncccn1.
What is the InChIKey of (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene?
The InChIKey is PWOSZDKTRWVQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.C6H10O/c1-15(2,3)13-6-5-11(10-18)9-12(13)14-16-7-4-8-17-14;1-3-5-7-6-4-2/h4-9,18H,10H2,1-3H3;3-4H,1-2,5-6H2.
What are the key properties of (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene?
(4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene has a molecular weight of 340.47 g/mol, XLogP of 4.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butyl-3-pyrimidin-2-ylphenyl)methanol;3-prop-2-enoxyprop-1-ene is sourced from PubChem (CID 70523119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).