About guanidine;1-nitropyrrole
guanidine;1-nitropyrrole (PubChem CID 70523594) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is guanidine;1-nitropyrrole.
Molecular Properties
| Compound Name | guanidine;1-nitropyrrole |
| PubChem CID | 70523594 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | guanidine;1-nitropyrrole |
| SMILES | O=[N+]([O-])n1cccc1.[H]N=C(N)N |
| InChI | InChI=1S/C4H4N2O2.CH5N3/c7-6(8)5-3-1-2-4-5;2-1(3)4/h1-4H;(H5,2,3,4) |
| InChIKey | OBFYBEWUUSJCLX-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze guanidine;1-nitropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;1-nitropyrrole?
The IUPAC name of guanidine;1-nitropyrrole (CID 70523594) is guanidine;1-nitropyrrole.
What is the SMILES notation for guanidine;1-nitropyrrole?
The canonical SMILES for guanidine;1-nitropyrrole is O=[N+]([O-])n1cccc1.[H]N=C(N)N.
What is the InChIKey of guanidine;1-nitropyrrole?
The InChIKey is OBFYBEWUUSJCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.CH5N3/c7-6(8)5-3-1-2-4-5;2-1(3)4/h1-4H;(H5,2,3,4).
What are the key properties of guanidine;1-nitropyrrole?
guanidine;1-nitropyrrole has a molecular weight of 171.16 g/mol, XLogP of -0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;1-nitropyrrole is sourced from PubChem (CID 70523594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).