About 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride
2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride (PubChem CID 70523697) has the molecular formula C22H43ClN2O
and a molecular weight of 387.05 g/mol. Its IUPAC name is 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride |
| PubChem CID | 70523697 |
| Molecular Formula | C22H43ClN2O |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 386.31 |
| IUPAC Name | 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride |
| SMILES | CCCCCCCCCCCCCCC=CCC1=NCCN1CCO.Cl |
| InChI | InChI=1S/C22H42N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25;/h15-16,25H,2-14,17-21H2,1H3;1H |
| InChIKey | MOBQOPCYAQMVEU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride?
The IUPAC name of 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride (CID 70523697) is 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride.
What is the SMILES notation for 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride?
The canonical SMILES for 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride is CCCCCCCCCCCCCCC=CCC1=NCCN1CCO.Cl.
What is the InChIKey of 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride?
The InChIKey is MOBQOPCYAQMVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-23-18-19-24(22)20-21-25;/h15-16,25H,2-14,17-21H2,1H3;1H.
What are the key properties of 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride?
2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride has a molecular weight of 387.05 g/mol, XLogP of 6.15, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-heptadec-2-enyl-4,5-dihydroimidazol-1-yl)ethanol;hydrochloride is sourced from PubChem (CID 70523697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).