C17H20N2O — CID 70523941
1-(4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,9(16),12-tetraen-6-yl)ethanone (PubChem CID 70523941) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,9(16),12-tetraen-6-yl)ethanone.
| Compound Name | 1-(4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,9(16),12-tetraen-6-yl)ethanone |
|---|---|
| PubChem CID | 70523941 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,9(16),12-tetraen-6-yl)ethanone |
| SMILES | CC(=O)C1NC(C)=CC2=C3CCC=C4NCC(=C43)CC21 |
| InChI | InChI=1S/C17H20N2O/c1-9-6-13-12-4-3-5-15-16(12)11(8-18-15)7-14(13)17(19-9)10(2)20/h5-6,14,17-19H,3-4,7-8H2,1-2H3 |
| InChIKey | KHSICRYWYUYIIS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |