C10H14O5P+ — CID 70524027
[2,3-bis(2-hydroxyethyl)phenoxy]-hydroxy-oxophosphanium (PubChem CID 70524027) has the molecular formula C10H14O5P+ and a molecular weight of 245.19 g/mol. Its IUPAC name is [2,3-bis(2-hydroxyethyl)phenoxy]-hydroxy-oxophosphanium.
| Compound Name | [2,3-bis(2-hydroxyethyl)phenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70524027 |
| Molecular Formula | C10H14O5P+ |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | [2,3-bis(2-hydroxyethyl)phenoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)Oc1cccc(CCO)c1CCO |
| InChI | InChI=1S/C10H13O5P/c11-6-4-8-2-1-3-10(15-16(13)14)9(8)5-7-12/h1-3,11-12H,4-7H2/p+1 |
| InChIKey | JAYFOPUJEFIIBX-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|