C12H15N3O6 — CID 70524359
(E)-3-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid (PubChem CID 70524359) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is (E)-3-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70524359 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (E)-3-[4-amino-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-5-yl]prop-2-enoic acid |
| SMILES | Nc1nc(=O)n([C@H]2CC(O)[C@@H](CO)O2)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C12H15N3O6/c13-11-6(1-2-10(18)19)4-15(12(20)14-11)9-3-7(17)8(5-16)21-9/h1-2,4,7-9,16-17H,3,5H2,(H,18,19)(H2,13,14,20)/b2-1+/t7?,8-,9-/m1/s1 |
| InChIKey | JEEPLDNEMJPHTF-GIANCMQGSA-N |
| XLogP | -1.44 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|