About cyclopropane;trimethyl-(prop-2-enoylamino)azanium
cyclopropane;trimethyl-(prop-2-enoylamino)azanium (PubChem CID 70524637) has the molecular formula C9H19N2O+
and a molecular weight of 171.26 g/mol. Its IUPAC name is cyclopropane;trimethyl-(prop-2-enoylamino)azanium.
Molecular Properties
| Compound Name | cyclopropane;trimethyl-(prop-2-enoylamino)azanium |
| PubChem CID | 70524637 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | cyclopropane;trimethyl-(prop-2-enoylamino)azanium |
| SMILES | C1CC1.C=CC(=O)N[N+](C)(C)C |
| InChI | InChI=1S/C6H12N2O.C3H6/c1-5-6(9)7-8(2,3)4;1-2-3-1/h5H,1H2,2-4H3;1-3H2/p+1 |
| InChIKey | DLXIYQABNBWBNA-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;trimethyl-(prop-2-enoylamino)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;trimethyl-(prop-2-enoylamino)azanium?
The IUPAC name of cyclopropane;trimethyl-(prop-2-enoylamino)azanium (CID 70524637) is cyclopropane;trimethyl-(prop-2-enoylamino)azanium.
What is the SMILES notation for cyclopropane;trimethyl-(prop-2-enoylamino)azanium?
The canonical SMILES for cyclopropane;trimethyl-(prop-2-enoylamino)azanium is C1CC1.C=CC(=O)N[N+](C)(C)C.
What is the InChIKey of cyclopropane;trimethyl-(prop-2-enoylamino)azanium?
The InChIKey is DLXIYQABNBWBNA-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H12N2O.C3H6/c1-5-6(9)7-8(2,3)4;1-2-3-1/h5H,1H2,2-4H3;1-3H2/p+1.
What are the key properties of cyclopropane;trimethyl-(prop-2-enoylamino)azanium?
cyclopropane;trimethyl-(prop-2-enoylamino)azanium has a molecular weight of 171.26 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;trimethyl-(prop-2-enoylamino)azanium is sourced from PubChem (CID 70524637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).