C18H24ClN3O2 — CID 70524751
1-[2-but-1-en-2-yloxy-1-(4-chlorophenoxy)-3,3-dimethylbutyl]-1,2,4-triazole (PubChem CID 70524751) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 1-[2-but-1-en-2-yloxy-1-(4-chlorophenoxy)-3,3-dimethylbutyl]-1,2,4-triazole.
| Compound Name | 1-[2-but-1-en-2-yloxy-1-(4-chlorophenoxy)-3,3-dimethylbutyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70524751 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[2-but-1-en-2-yloxy-1-(4-chlorophenoxy)-3,3-dimethylbutyl]-1,2,4-triazole |
| SMILES | C=C(CC)OC(C(Oc1ccc(Cl)cc1)n1cncn1)C(C)(C)C |
| InChI | InChI=1S/C18H24ClN3O2/c1-6-13(2)23-16(18(3,4)5)17(22-12-20-11-21-22)24-15-9-7-14(19)8-10-15/h7-12,16-17H,2,6H2,1,3-5H3 |
| InChIKey | RXAUCSDSZODCLS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|