C22H35FO6 — CID 70524787
(E,2S)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid (PubChem CID 70524787) has the molecular formula C22H35FO6 and a molecular weight of 414.51 g/mol. Its IUPAC name is (E,2S)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid.
| Compound Name | (E,2S)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid |
|---|---|
| PubChem CID | 70524787 |
| Molecular Formula | C22H35FO6 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (E,2S)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid |
| SMILES | CCCCC(F)C/C=C(/O)[C@](C(=O)O)(C1CCCC1)[C@H](O)C/C=C\CC(=O)OC |
| InChI | InChI=1S/C22H35FO6/c1-3-4-11-17(23)14-15-19(25)22(21(27)28,16-9-5-6-10-16)18(24)12-7-8-13-20(26)29-2/h7-8,15-18,24-25H,3-6,9-14H2,1-2H3,(H,27,28)/b8-7-,19-15+/t17?,18-,22+/m1/s1 |
| InChIKey | DAIIBNKNBXBSEC-PHUNVMFDSA-N |
| XLogP | 4.48 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|