About 1-benzofuran;sulfamic acid
1-benzofuran;sulfamic acid (PubChem CID 70525210) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is 1-benzofuran;sulfamic acid.
Molecular Properties
| Compound Name | 1-benzofuran;sulfamic acid |
| PubChem CID | 70525210 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 1-benzofuran;sulfamic acid |
| SMILES | NS(=O)(=O)O.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.H3NO3S/c1-2-4-8-7(3-1)5-6-9-8;1-5(2,3)4/h1-6H;(H3,1,2,3,4) |
| InChIKey | VAJFOBZYAGAKON-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran;sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;sulfamic acid?
The IUPAC name of 1-benzofuran;sulfamic acid (CID 70525210) is 1-benzofuran;sulfamic acid.
What is the SMILES notation for 1-benzofuran;sulfamic acid?
The canonical SMILES for 1-benzofuran;sulfamic acid is NS(=O)(=O)O.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;sulfamic acid?
The InChIKey is VAJFOBZYAGAKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.H3NO3S/c1-2-4-8-7(3-1)5-6-9-8;1-5(2,3)4/h1-6H;(H3,1,2,3,4).
What are the key properties of 1-benzofuran;sulfamic acid?
1-benzofuran;sulfamic acid has a molecular weight of 215.23 g/mol, XLogP of 1.18, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;sulfamic acid is sourced from PubChem (CID 70525210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).