About ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate
ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate (PubChem CID 70525362) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate |
| PubChem CID | 70525362 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate |
| SMILES | CCOC(=O)N(C(=O)COC)c1c(C)ccc(C2CC2)c1C |
| InChI | InChI=1S/C17H23NO4/c1-5-22-17(20)18(15(19)10-21-4)16-11(2)6-9-14(12(16)3)13-7-8-13/h6,9,13H,5,7-8,10H2,1-4H3 |
| InChIKey | DTKNDLZLQLGYPV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate?
The IUPAC name of ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate (CID 70525362) is ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate.
What is the SMILES notation for ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate?
The canonical SMILES for ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate is CCOC(=O)N(C(=O)COC)c1c(C)ccc(C2CC2)c1C.
What is the InChIKey of ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate?
The InChIKey is DTKNDLZLQLGYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-5-22-17(20)18(15(19)10-21-4)16-11(2)6-9-14(12(16)3)13-7-8-13/h6,9,13H,5,7-8,10H2,1-4H3.
What are the key properties of ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate?
ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate has a molecular weight of 305.37 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(3-cyclopropyl-2,6-dimethylphenyl)-N-(2-methoxyacetyl)carbamate is sourced from PubChem (CID 70525362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).