C23H42O5Si — CID 70525382
methyl (3aR,4S,5S,6aR)-4-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate (PubChem CID 70525382) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is methyl (3aR,4S,5S,6aR)-4-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate.
| Compound Name | methyl (3aR,4S,5S,6aR)-4-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate |
|---|---|
| PubChem CID | 70525382 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | methyl (3aR,4S,5S,6aR)-4-[8-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2OC(O)C[C@@H]2[C@@H]1C=CCCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O5Si/c1-23(2,3)29(5,6)27-14-12-10-8-7-9-11-13-17-18-16-21(24)28-20(18)15-19(17)22(25)26-4/h11,13,17-21,24H,7-10,12,14-16H2,1-6H3/t17-,18+,19-,20+,21?/m0/s1 |
| InChIKey | HEWLXFUVTWWHKL-JFROBXPVSA-N |
| XLogP | 5.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|