C17H25FO5 — CID 70525399
methyl (3aR,4S,5S,6aR)-4-(4-fluoro-1-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate (PubChem CID 70525399) has the molecular formula C17H25FO5 and a molecular weight of 328.38 g/mol. Its IUPAC name is methyl (3aR,4S,5S,6aR)-4-(4-fluoro-1-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate.
| Compound Name | methyl (3aR,4S,5S,6aR)-4-(4-fluoro-1-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
|---|---|
| PubChem CID | 70525399 |
| Molecular Formula | C17H25FO5 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | methyl (3aR,4S,5S,6aR)-4-(4-fluoro-1-hydroxyoct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
| SMILES | CCCCC(F)CC=C(O)[C@H]1[C@H]2CC(=O)O[C@@H]2C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C17H25FO5/c1-3-4-5-10(18)6-7-13(19)16-11-9-15(20)23-14(11)8-12(16)17(21)22-2/h7,10-12,14,16,19H,3-6,8-9H2,1-2H3/t10?,11-,12-,14+,16-/m0/s1 |
| InChIKey | FXXOUNRRWDRHAP-LFBZHROHSA-N |
| XLogP | 3.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|