About N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide
N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide (PubChem CID 70525400) has the molecular formula C9H13ClN2
and a molecular weight of 184.67 g/mol. Its IUPAC name is N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide |
| PubChem CID | 70525400 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide |
| SMILES | C/N=C/NC1C=CC=CC1(C)Cl |
| InChI | InChI=1S/C9H13ClN2/c1-9(10)6-4-3-5-8(9)12-7-11-2/h3-8H,1-2H3,(H,11,12) |
| InChIKey | VWFXAITUCDUPBU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide?
The IUPAC name of N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide (CID 70525400) is N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide.
What is the SMILES notation for N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide?
The canonical SMILES for N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide is C/N=C/NC1C=CC=CC1(C)Cl.
What is the InChIKey of N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide?
The InChIKey is VWFXAITUCDUPBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2/c1-9(10)6-4-3-5-8(9)12-7-11-2/h3-8H,1-2H3,(H,11,12).
What are the key properties of N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide?
N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide has a molecular weight of 184.67 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-6-methylcyclohexa-2,4-dien-1-yl)-N'-methylmethanimidamide is sourced from PubChem (CID 70525400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).