C28H50O6Si — CID 70525494
(Z,2R)-10-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-2-[(E)-5-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid (PubChem CID 70525494) has the molecular formula C28H50O6Si and a molecular weight of 510.79 g/mol. Its IUPAC name is (Z,2R)-10-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-2-[(E)-5-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid.
| Compound Name | (Z,2R)-10-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-2-[(E)-5-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid |
|---|---|
| PubChem CID | 70525494 |
| Molecular Formula | C28H50O6Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (Z,2R)-10-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentyl-2-[(E)-5-hydroxy-6-methoxy-6-oxohex-3-enyl]dec-3-enoic acid |
| SMILES | COC(=O)C(O)/C=C/CC[C@@](/C=C\CCCCCCO[Si](C)(C)C(C)(C)C)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C28H50O6Si/c1-27(2,3)35(5,6)34-22-16-10-8-7-9-14-20-28(26(31)32,23-17-11-12-18-23)21-15-13-19-24(29)25(30)33-4/h13-14,19-20,23-24,29H,7-12,15-18,21-22H2,1-6H3,(H,31,32)/b19-13+,20-14-/t24?,28-/m1/s1 |
| InChIKey | HGFHTLFHPAWNSJ-DLJHQQLSSA-N |
| XLogP | 6.65 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|