C22H46N4 — CID 70525578
1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 70525578) has the molecular formula C22H46N4 and a molecular weight of 366.64 g/mol. Its IUPAC name is 1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)ethane-1,2-diamine.
| Compound Name | 1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 70525578 |
| Molecular Formula | C22H46N4 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.37 |
| IUPAC Name | 1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CN1C(C)(C)CC(C(N)(CN)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C22H46N4/c1-18(2)11-16(12-19(3,4)25(18)9)22(24,15-23)17-13-20(5,6)26(10)21(7,8)14-17/h16-17H,11-15,23-24H2,1-10H3 |
| InChIKey | KZPTZKAYOCOLIU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |