C19H30O5 — CID 70525582
methyl (3aR,4S,5S,6aR)-4-(1-hydroxy-4,4-dimethyloct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate (PubChem CID 70525582) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is methyl (3aR,4S,5S,6aR)-4-(1-hydroxy-4,4-dimethyloct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate.
| Compound Name | methyl (3aR,4S,5S,6aR)-4-(1-hydroxy-4,4-dimethyloct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
|---|---|
| PubChem CID | 70525582 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | methyl (3aR,4S,5S,6aR)-4-(1-hydroxy-4,4-dimethyloct-1-enyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
| SMILES | CCCCC(C)(C)CC=C(O)[C@H]1[C@H]2CC(=O)O[C@@H]2C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C19H30O5/c1-5-6-8-19(2,3)9-7-14(20)17-12-11-16(21)24-15(12)10-13(17)18(22)23-4/h7,12-13,15,17,20H,5-6,8-11H2,1-4H3/t12-,13-,15+,17-/m0/s1 |
| InChIKey | UPKOZHMARGELOB-LBEHMCEESA-N |
| XLogP | 3.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|