About sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate
sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate (PubChem CID 70525727) has the molecular formula C10H17NNaO6PS
and a molecular weight of 333.28 g/mol. Its IUPAC name is sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate.
Molecular Properties
| Compound Name | sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate |
| PubChem CID | 70525727 |
| Molecular Formula | C10H17NNaO6PS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate |
| SMILES | CCOC(=O)C1CSCN1C(=O)C(C)CP(=O)([O-])O.[Na+] |
| InChI | InChI=1S/C10H18NO6PS.Na/c1-3-17-10(13)8-5-19-6-11(8)9(12)7(2)4-18(14,15)16;/h7-8H,3-6H2,1-2H3,(H2,14,15,16);/q;+1/p-1 |
| InChIKey | XJJUGLXYSJVKHL-UHFFFAOYSA-M |
| XLogP | -3.36 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate?
The IUPAC name of sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate (CID 70525727) is sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate.
What is the SMILES notation for sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate?
The canonical SMILES for sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate is CCOC(=O)C1CSCN1C(=O)C(C)CP(=O)([O-])O.[Na+].
What is the InChIKey of sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate?
The InChIKey is XJJUGLXYSJVKHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18NO6PS.Na/c1-3-17-10(13)8-5-19-6-11(8)9(12)7(2)4-18(14,15)16;/h7-8H,3-6H2,1-2H3,(H2,14,15,16);/q;+1/p-1.
What are the key properties of sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate?
sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate has a molecular weight of 333.28 g/mol, XLogP of -3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]-hydroxyphosphinate is sourced from PubChem (CID 70525727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).