4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid

C8H9NO6 — CID 70525741

IUPAC4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)OC1CC(=O)NC1=O
InChIInChI=1S/C8H9NO6/c10-5-3-4(8(14)9-5)15-7(13)2-1-6(11)12/h4H,1-3H2,(H,11,12)(H,9,10,14)
InChIKeyJBZUBSSRJUURQT-UHFFFAOYSA-N
MW215.16 g/mol
LogP-1.19
Rot. Bonds4

About 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid

4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid (PubChem CID 70525741) has the molecular formula C8H9NO6 and a molecular weight of 215.16 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid
PubChem CID70525741
Molecular FormulaC8H9NO6
Molecular Weight215.16 g/mol
Exact Mass215.04
IUPAC Name4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)OC1CC(=O)NC1=O
InChIInChI=1S/C8H9NO6/c10-5-3-4(8(14)9-5)15-7(13)2-1-6(11)12/h4H,1-3H2,(H,11,12)(H,9,10,14)
InChIKeyJBZUBSSRJUURQT-UHFFFAOYSA-N
XLogP-1.19
TPSA109.77 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.16
LogP ≤ 5-1.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid?
The IUPAC name of 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid (CID 70525741) is 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid.
What is the SMILES notation for 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid?
The canonical SMILES for 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid is O=C(O)CCC(=O)OC1CC(=O)NC1=O.
What is the InChIKey of 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid?
The InChIKey is JBZUBSSRJUURQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO6/c10-5-3-4(8(14)9-5)15-7(13)2-1-6(11)12/h4H,1-3H2,(H,11,12)(H,9,10,14).
What are the key properties of 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid?
4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid has a molecular weight of 215.16 g/mol, XLogP of -1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrolidin-3-yl)oxy-4-oxobutanoic acid is sourced from PubChem (CID 70525741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).