C22H34O6 — CID 70525950
methyl (3aR,4S,5S,6aR)-4-[8-(oxan-2-yloxy)oct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate (PubChem CID 70525950) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is methyl (3aR,4S,5S,6aR)-4-[8-(oxan-2-yloxy)oct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate.
| Compound Name | methyl (3aR,4S,5S,6aR)-4-[8-(oxan-2-yloxy)oct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
|---|---|
| PubChem CID | 70525950 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | methyl (3aR,4S,5S,6aR)-4-[8-(oxan-2-yloxy)oct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2OC(=O)C[C@@H]2[C@@H]1C=CCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C22H34O6/c1-25-22(24)18-14-19-17(15-20(23)28-19)16(18)10-6-4-2-3-5-8-12-26-21-11-7-9-13-27-21/h6,10,16-19,21H,2-5,7-9,11-15H2,1H3/t16-,17+,18-,19+,21?/m0/s1 |
| InChIKey | MGUZFLXXXIQKMR-DGASXKFOSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|