C21H35FO4 — CID 70525990
(E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]dec-3-enoic acid (PubChem CID 70525990) has the molecular formula C21H35FO4 and a molecular weight of 370.51 g/mol. Its IUPAC name is (E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]dec-3-enoic acid.
| Compound Name | (E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]dec-3-enoic acid |
|---|---|
| PubChem CID | 70525990 |
| Molecular Formula | C21H35FO4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]dec-3-enoic acid |
| SMILES | CC/C=C\C[C@@H](O)[C@@](C(=O)O)(/C(O)=C\CC(F)CCCC)C1CCCC1 |
| InChI | InChI=1S/C21H35FO4/c1-3-5-7-13-18(23)21(20(25)26,16-10-8-9-11-16)19(24)15-14-17(22)12-6-4-2/h5,7,15-18,23-24H,3-4,6,8-14H2,1-2H3,(H,25,26)/b7-5-,19-15+/t17?,18-,21-/m1/s1 |
| InChIKey | PVGJSYHWCJDFKZ-HPVDCHBTSA-N |
| XLogP | 5.33 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|