C22H37FO4 — CID 70526010
(E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]-6-methyldec-3-enoic acid (PubChem CID 70526010) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is (E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]-6-methyldec-3-enoic acid.
| Compound Name | (E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]-6-methyldec-3-enoic acid |
|---|---|
| PubChem CID | 70526010 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (E,2R)-2-cyclopentyl-6-fluoro-3-hydroxy-2-[(Z,1R)-1-hydroxyhex-3-enyl]-6-methyldec-3-enoic acid |
| SMILES | CC/C=C\C[C@@H](O)[C@@](C(=O)O)(/C(O)=C\CC(C)(F)CCCC)C1CCCC1 |
| InChI | InChI=1S/C22H37FO4/c1-4-6-8-13-18(24)22(20(26)27,17-11-9-10-12-17)19(25)14-16-21(3,23)15-7-5-2/h6,8,14,17-18,24-25H,4-5,7,9-13,15-16H2,1-3H3,(H,26,27)/b8-6-,19-14+/t18-,21?,22-/m1/s1 |
| InChIKey | WRZKPFLBQHRIAA-LWYUXJTFSA-N |
| XLogP | 5.72 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|