About 4-aminobenzene-1,2-diol;ethene;ethoxyethane
4-aminobenzene-1,2-diol;ethene;ethoxyethane (PubChem CID 70526305) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 4-aminobenzene-1,2-diol;ethene;ethoxyethane.
Molecular Properties
| Compound Name | 4-aminobenzene-1,2-diol;ethene;ethoxyethane |
| PubChem CID | 70526305 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4-aminobenzene-1,2-diol;ethene;ethoxyethane |
| SMILES | C=C.CCOCC.Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C6H7NO2.C4H10O.C2H4/c7-4-1-2-5(8)6(9)3-4;1-3-5-4-2;1-2/h1-3,8-9H,7H2;3-4H2,1-2H3;1-2H2 |
| InChIKey | MOZKRNJPFMINRP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzene-1,2-diol;ethene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzene-1,2-diol;ethene;ethoxyethane?
The IUPAC name of 4-aminobenzene-1,2-diol;ethene;ethoxyethane (CID 70526305) is 4-aminobenzene-1,2-diol;ethene;ethoxyethane.
What is the SMILES notation for 4-aminobenzene-1,2-diol;ethene;ethoxyethane?
The canonical SMILES for 4-aminobenzene-1,2-diol;ethene;ethoxyethane is C=C.CCOCC.Nc1ccc(O)c(O)c1.
What is the InChIKey of 4-aminobenzene-1,2-diol;ethene;ethoxyethane?
The InChIKey is MOZKRNJPFMINRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C4H10O.C2H4/c7-4-1-2-5(8)6(9)3-4;1-3-5-4-2;1-2/h1-3,8-9H,7H2;3-4H2,1-2H3;1-2H2.
What are the key properties of 4-aminobenzene-1,2-diol;ethene;ethoxyethane?
4-aminobenzene-1,2-diol;ethene;ethoxyethane has a molecular weight of 227.30 g/mol, XLogP of 2.53, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzene-1,2-diol;ethene;ethoxyethane is sourced from PubChem (CID 70526305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).