C24H42O5 — CID 70526483
4-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 70526483) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is 4-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | 4-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 70526483 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 4-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(C)C(/C=C/C1C(COC)CC2OC(O)CC21)OC1CCCCO1 |
| InChI | InChI=1S/C24H42O5/c1-5-6-12-24(2,3)21(29-23-9-7-8-13-27-23)11-10-18-17(16-26-4)14-20-19(18)15-22(25)28-20/h10-11,17-23,25H,5-9,12-16H2,1-4H3/b11-10+ |
| InChIKey | CEUXSQQHCFYVAK-ZHACJKMWSA-N |
| XLogP | 4.68 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|