About [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid
[3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid (PubChem CID 70526874) has the molecular formula C9H16NO6PS
and a molecular weight of 297.27 g/mol. Its IUPAC name is [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid.
Molecular Properties
| Compound Name | [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid |
| PubChem CID | 70526874 |
| Molecular Formula | C9H16NO6PS |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid |
| SMILES | COC(=O)C1CSCN1C(=O)C(C)CP(=O)(O)O |
| InChI | InChI=1S/C9H16NO6PS/c1-6(3-17(13,14)15)8(11)10-5-18-4-7(10)9(12)16-2/h6-7H,3-5H2,1-2H3,(H2,13,14,15) |
| InChIKey | LPANTWRXORYILY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid?
The IUPAC name of [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid (CID 70526874) is [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid.
What is the SMILES notation for [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid?
The canonical SMILES for [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid is COC(=O)C1CSCN1C(=O)C(C)CP(=O)(O)O.
What is the InChIKey of [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid?
The InChIKey is LPANTWRXORYILY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16NO6PS/c1-6(3-17(13,14)15)8(11)10-5-18-4-7(10)9(12)16-2/h6-7H,3-5H2,1-2H3,(H2,13,14,15).
What are the key properties of [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid?
[3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid has a molecular weight of 297.27 g/mol, XLogP of -0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methoxycarbonyl-1,3-thiazolidin-3-yl)-2-methyl-3-oxopropyl]phosphonic acid is sourced from PubChem (CID 70526874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).