About 2H-cyclopenta[b]furan;methane
2H-cyclopenta[b]furan;methane (PubChem CID 70527043) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2H-cyclopenta[b]furan;methane.
Molecular Properties
| Compound Name | 2H-cyclopenta[b]furan;methane |
| PubChem CID | 70527043 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2H-cyclopenta[b]furan;methane |
| SMILES | C.C1=CC2=CCOC2=C1 |
| InChI | InChI=1S/C7H6O.CH4/c1-2-6-4-5-8-7(6)3-1;/h1-4H,5H2;1H4 |
| InChIKey | ZVGCXMSOJNAGNR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-cyclopenta[b]furan;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-cyclopenta[b]furan;methane?
The IUPAC name of 2H-cyclopenta[b]furan;methane (CID 70527043) is 2H-cyclopenta[b]furan;methane.
What is the SMILES notation for 2H-cyclopenta[b]furan;methane?
The canonical SMILES for 2H-cyclopenta[b]furan;methane is C.C1=CC2=CCOC2=C1.
What is the InChIKey of 2H-cyclopenta[b]furan;methane?
The InChIKey is ZVGCXMSOJNAGNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.CH4/c1-2-6-4-5-8-7(6)3-1;/h1-4H,5H2;1H4.
What are the key properties of 2H-cyclopenta[b]furan;methane?
2H-cyclopenta[b]furan;methane has a molecular weight of 122.17 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-cyclopenta[b]furan;methane is sourced from PubChem (CID 70527043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).