C18H24N4 — CID 705271
1,4-di(piperidin-1-yl)phthalazine (PubChem CID 705271) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 1,4-di(piperidin-1-yl)phthalazine.
| Compound Name | 1,4-di(piperidin-1-yl)phthalazine |
|---|---|
| PubChem CID | 705271 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1,4-di(piperidin-1-yl)phthalazine |
| SMILES | c1ccc2c(N3CCCCC3)nnc(N3CCCCC3)c2c1 |
| InChI | InChI=1S/C18H24N4/c1-5-11-21(12-6-1)17-15-9-3-4-10-16(15)18(20-19-17)22-13-7-2-8-14-22/h3-4,9-10H,1-2,5-8,11-14H2 |
| InChIKey | YLRRRHGLFHADEI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |