C22H39NO5 — CID 70527273
ethyl 5-[4-(3-hydroxynonyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-2-yl]pentanoate (PubChem CID 70527273) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is ethyl 5-[4-(3-hydroxynonyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-2-yl]pentanoate.
| Compound Name | ethyl 5-[4-(3-hydroxynonyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-2-yl]pentanoate |
|---|---|
| PubChem CID | 70527273 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | ethyl 5-[4-(3-hydroxynonyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-2-yl]pentanoate |
| SMILES | CCCCCCC(O)CCN1C(=O)CC2OC(CCCCC(=O)OCC)CC21 |
| InChI | InChI=1S/C22H39NO5/c1-3-5-6-7-10-17(24)13-14-23-19-15-18(28-20(19)16-21(23)25)11-8-9-12-22(26)27-4-2/h17-20,24H,3-16H2,1-2H3 |
| InChIKey | LUQHASYOUSOWJW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|