C28H23F4N5S — CID 70527636
3-[3-(2-fluoro-1-tritylimidazol-4-yl)propylsulfanyl]-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 70527636) has the molecular formula C28H23F4N5S and a molecular weight of 537.59 g/mol. Its IUPAC name is 3-[3-(2-fluoro-1-tritylimidazol-4-yl)propylsulfanyl]-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-[3-(2-fluoro-1-tritylimidazol-4-yl)propylsulfanyl]-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 70527636 |
| Molecular Formula | C28H23F4N5S |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 3-[3-(2-fluoro-1-tritylimidazol-4-yl)propylsulfanyl]-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | Fc1nc(CCCSc2n[nH]c(C(F)(F)F)n2)cn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23F4N5S/c29-25-33-23(17-10-18-38-26-34-24(35-36-26)28(30,31)32)19-37(25)27(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,19H,10,17-18H2,(H,34,35,36) |
| InChIKey | OAOCBNUERFEHDT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|