C18H34N4O2 — CID 70528149
3,4,5,5-tetramethyl-1-[2-(3,4,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 70528149) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 3,4,5,5-tetramethyl-1-[2-(3,4,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 3,4,5,5-tetramethyl-1-[2-(3,4,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 70528149 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 3,4,5,5-tetramethyl-1-[2-(3,4,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CC1C(=O)N(CCN2CC(C)(C)N(C)C(C)C2=O)CC(C)(C)N1C |
| InChI | InChI=1S/C18H34N4O2/c1-13-15(23)21(11-17(3,4)19(13)7)9-10-22-12-18(5,6)20(8)14(2)16(22)24/h13-14H,9-12H2,1-8H3 |
| InChIKey | PYPDLPCWFYTKPB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |