About (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine
(4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine (PubChem CID 70528160) has the molecular formula C13H12NO2P
and a molecular weight of 245.22 g/mol. Its IUPAC name is (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine.
Molecular Properties
| Compound Name | (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine |
| PubChem CID | 70528160 |
| Molecular Formula | C13H12NO2P |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine |
| SMILES | NP1Oc2ccccc2/C=C2/C=CC=CC2O1 |
| InChI | InChI=1S/C13H12NO2P/c14-17-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)16-17/h1-9,12H,14H2/b10-9- |
| InChIKey | DTUQJICQFLHNHZ-KTKRTIGZSA-N |
| XLogP | 3.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine?
The IUPAC name of (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine (CID 70528160) is (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine.
What is the SMILES notation for (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine?
The canonical SMILES for (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine is NP1Oc2ccccc2/C=C2/C=CC=CC2O1.
What is the InChIKey of (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine?
The InChIKey is DTUQJICQFLHNHZ-KTKRTIGZSA-N. The full InChI is InChI=1S/C13H12NO2P/c14-17-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)16-17/h1-9,12H,14H2/b10-9-.
What are the key properties of (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine?
(4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine has a molecular weight of 245.22 g/mol, XLogP of 3.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4aZ)-12aH-benzo[d][1,3,2]benzodioxaphosphocin-11-amine is sourced from PubChem (CID 70528160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).