About 3H-thieno[3,4-b][1,5]benzodiazepine
3H-thieno[3,4-b][1,5]benzodiazepine (PubChem CID 70528379) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 3H-thieno[3,4-b][1,5]benzodiazepine.
Molecular Properties
| Compound Name | 3H-thieno[3,4-b][1,5]benzodiazepine |
| PubChem CID | 70528379 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3H-thieno[3,4-b][1,5]benzodiazepine |
| SMILES | C1=C2CSC=C2N=c2ccccc2=N1 |
| InChI | InChI=1S/C11H8N2S/c1-2-4-10-9(3-1)12-5-8-6-14-7-11(8)13-10/h1-5,7H,6H2 |
| InChIKey | VYCOLKDMMRNXKM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-thieno[3,4-b][1,5]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-thieno[3,4-b][1,5]benzodiazepine?
The IUPAC name of 3H-thieno[3,4-b][1,5]benzodiazepine (CID 70528379) is 3H-thieno[3,4-b][1,5]benzodiazepine.
What is the SMILES notation for 3H-thieno[3,4-b][1,5]benzodiazepine?
The canonical SMILES for 3H-thieno[3,4-b][1,5]benzodiazepine is C1=C2CSC=C2N=c2ccccc2=N1.
What is the InChIKey of 3H-thieno[3,4-b][1,5]benzodiazepine?
The InChIKey is VYCOLKDMMRNXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-2-4-10-9(3-1)12-5-8-6-14-7-11(8)13-10/h1-5,7H,6H2.
What are the key properties of 3H-thieno[3,4-b][1,5]benzodiazepine?
3H-thieno[3,4-b][1,5]benzodiazepine has a molecular weight of 200.27 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-thieno[3,4-b][1,5]benzodiazepine is sourced from PubChem (CID 70528379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).