C2H2ClN3O — CID 70528952
3-chloro-3,4-dihydro-1,2,4-triazol-5-one (PubChem CID 70528952) has the molecular formula C2H2ClN3O and a molecular weight of 119.51 g/mol. Its IUPAC name is 3-chloro-3,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-chloro-3,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 70528952 |
| Molecular Formula | C2H2ClN3O |
| Molecular Weight | 119.51 g/mol |
| Exact Mass | 118.99 |
| IUPAC Name | 3-chloro-3,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=C1N=NC(Cl)N1 |
| InChI | InChI=1S/C2H2ClN3O/c3-1-4-2(7)6-5-1/h1H,(H,4,7) |
| InChIKey | PNFSCTSQQYZILR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|