About [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid
[3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid (PubChem CID 70529152) has the molecular formula C10H18NO6PS
and a molecular weight of 311.30 g/mol. Its IUPAC name is [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid.
Molecular Properties
| Compound Name | [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid |
| PubChem CID | 70529152 |
| Molecular Formula | C10H18NO6PS |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid |
| SMILES | CCOC(=O)C1CSCN1CC(C)C(=O)P(=O)(O)O |
| InChI | InChI=1S/C10H18NO6PS/c1-3-17-9(12)8-5-19-6-11(8)4-7(2)10(13)18(14,15)16/h7-8H,3-6H2,1-2H3,(H2,14,15,16) |
| InChIKey | VFTZTNIHIXDZMK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid?
The IUPAC name of [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid (CID 70529152) is [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid.
What is the SMILES notation for [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid?
The canonical SMILES for [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid is CCOC(=O)C1CSCN1CC(C)C(=O)P(=O)(O)O.
What is the InChIKey of [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid?
The InChIKey is VFTZTNIHIXDZMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NO6PS/c1-3-17-9(12)8-5-19-6-11(8)4-7(2)10(13)18(14,15)16/h7-8H,3-6H2,1-2H3,(H2,14,15,16).
What are the key properties of [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid?
[3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid has a molecular weight of 311.30 g/mol, XLogP of 0.26, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-ethoxycarbonyl-1,3-thiazolidin-3-yl)-2-methylpropanoyl]phosphonic acid is sourced from PubChem (CID 70529152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).