About (2-methoxyquinolin-3-yl) hydrogen carbonate
(2-methoxyquinolin-3-yl) hydrogen carbonate (PubChem CID 70529555) has the molecular formula C11H9NO4
and a molecular weight of 219.20 g/mol. Its IUPAC name is (2-methoxyquinolin-3-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-methoxyquinolin-3-yl) hydrogen carbonate |
| PubChem CID | 70529555 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2-methoxyquinolin-3-yl) hydrogen carbonate |
| SMILES | COc1nc2ccccc2cc1OC(=O)O |
| InChI | InChI=1S/C11H9NO4/c1-15-10-9(16-11(13)14)6-7-4-2-3-5-8(7)12-10/h2-6H,1H3,(H,13,14) |
| InChIKey | ILAJKQXKTHTXSH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methoxyquinolin-3-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyquinolin-3-yl) hydrogen carbonate?
The IUPAC name of (2-methoxyquinolin-3-yl) hydrogen carbonate (CID 70529555) is (2-methoxyquinolin-3-yl) hydrogen carbonate.
What is the SMILES notation for (2-methoxyquinolin-3-yl) hydrogen carbonate?
The canonical SMILES for (2-methoxyquinolin-3-yl) hydrogen carbonate is COc1nc2ccccc2cc1OC(=O)O.
What is the InChIKey of (2-methoxyquinolin-3-yl) hydrogen carbonate?
The InChIKey is ILAJKQXKTHTXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4/c1-15-10-9(16-11(13)14)6-7-4-2-3-5-8(7)12-10/h2-6H,1H3,(H,13,14).
What are the key properties of (2-methoxyquinolin-3-yl) hydrogen carbonate?
(2-methoxyquinolin-3-yl) hydrogen carbonate has a molecular weight of 219.20 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyquinolin-3-yl) hydrogen carbonate is sourced from PubChem (CID 70529555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).