C20H24O6 — CID 70529802
(3-benzoyloxy-2-methylpropyl) benzoate;ethane-1,2-diol (PubChem CID 70529802) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (3-benzoyloxy-2-methylpropyl) benzoate;ethane-1,2-diol.
| Compound Name | (3-benzoyloxy-2-methylpropyl) benzoate;ethane-1,2-diol |
|---|---|
| PubChem CID | 70529802 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (3-benzoyloxy-2-methylpropyl) benzoate;ethane-1,2-diol |
| SMILES | CC(COC(=O)c1ccccc1)COC(=O)c1ccccc1.OCCO |
| InChI | InChI=1S/C18H18O4.C2H6O2/c1-14(12-21-17(19)15-8-4-2-5-9-15)13-22-18(20)16-10-6-3-7-11-16;3-1-2-4/h2-11,14H,12-13H2,1H3;3-4H,1-2H2 |
| InChIKey | HVNYERNOEWADLO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |