C39H64N2O4 — CID 70529839
3,3-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid (PubChem CID 70529839) has the molecular formula C39H64N2O4 and a molecular weight of 624.95 g/mol. Its IUPAC name is 3,3-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid.
| Compound Name | 3,3-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid |
|---|---|
| PubChem CID | 70529839 |
| Molecular Formula | C39H64N2O4 |
| Molecular Weight | 624.95 g/mol |
| Exact Mass | 624.49 |
| IUPAC Name | 3,3-bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid |
| SMILES | C=CC(C(C(=O)O)C(=O)OCc1ccccc1)(C1CC(C)(CC)N(C)C(C)(CC)C1C)C1CC(C)(CC)N(C)C(C)(CC)C1C |
| InChI | InChI=1S/C39H64N2O4/c1-14-35(8)24-30(27(6)37(10,16-3)40(35)12)39(18-5,31-25-36(9,15-2)41(13)38(11,17-4)28(31)7)32(33(42)43)34(44)45-26-29-22-20-19-21-23-29/h18-23,27-28,30-32H,5,14-17,24-26H2,1-4,6-13H3,(H,42,43) |
| InChIKey | XSAJRWGTMFCZAA-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.95 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|