C15H18IN3O3S2 — CID 70529923
methyl N'-[5-(methanesulfonamido)-2-phenoxyphenyl]carbamimidothioate;hydroiodide (PubChem CID 70529923) has the molecular formula C15H18IN3O3S2 and a molecular weight of 479.37 g/mol. Its IUPAC name is methyl N'-[5-(methanesulfonamido)-2-phenoxyphenyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[5-(methanesulfonamido)-2-phenoxyphenyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 70529923 |
| Molecular Formula | C15H18IN3O3S2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.98 |
| IUPAC Name | methyl N'-[5-(methanesulfonamido)-2-phenoxyphenyl]carbamimidothioate;hydroiodide |
| SMILES | CS/C(N)=N\c1cc(NS(C)(=O)=O)ccc1Oc1ccccc1.I |
| InChI | InChI=1S/C15H17N3O3S2.HI/c1-22-15(16)17-13-10-11(18-23(2,19)20)8-9-14(13)21-12-6-4-3-5-7-12;/h3-10,18H,1-2H3,(H2,16,17);1H |
| InChIKey | FGNOZGXGJZURRT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|