C16H17N3O — CID 70529937
2,2,4-trimethyl-6-pyridin-2-yloxy-1H-1,5-naphthyridine (PubChem CID 70529937) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-pyridin-2-yloxy-1H-1,5-naphthyridine.
| Compound Name | 2,2,4-trimethyl-6-pyridin-2-yloxy-1H-1,5-naphthyridine |
|---|---|
| PubChem CID | 70529937 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2,2,4-trimethyl-6-pyridin-2-yloxy-1H-1,5-naphthyridine |
| SMILES | CC1=CC(C)(C)Nc2ccc(Oc3ccccn3)nc21 |
| InChI | InChI=1S/C16H17N3O/c1-11-10-16(2,3)19-12-7-8-14(18-15(11)12)20-13-6-4-5-9-17-13/h4-10,19H,1-3H3 |
| InChIKey | VFIBEQKVGNEOMA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |