C22H39IO6Si — CID 70529964
methyl 5-[(3aR,4S,5R,6aS)-5-acetyloxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 70529964) has the molecular formula C22H39IO6Si and a molecular weight of 554.54 g/mol. Its IUPAC name is methyl 5-[(3aR,4S,5R,6aS)-5-acetyloxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl 5-[(3aR,4S,5R,6aS)-5-acetyloxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 70529964 |
| Molecular Formula | C22H39IO6Si |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | methyl 5-[(3aR,4S,5R,6aS)-5-acetyloxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | COC(=O)CCCC(I)C1C[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](OC(C)=O)C[C@@H]2O1 |
| InChI | InChI=1S/C22H39IO6Si/c1-14(24)28-19-12-18-15(16(19)13-27-30(6,7)22(2,3)4)11-20(29-18)17(23)9-8-10-21(25)26-5/h15-20H,8-13H2,1-7H3/t15-,16-,17?,18+,19-,20?/m1/s1 |
| InChIKey | DGGJTLKWDSJTAO-MWJOQKTBSA-N |
| XLogP | 4.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|