C33H52N2O4 — CID 70530080
3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid (PubChem CID 70530080) has the molecular formula C33H52N2O4 and a molecular weight of 540.79 g/mol. Its IUPAC name is 3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid.
| Compound Name | 3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid |
|---|---|
| PubChem CID | 70530080 |
| Molecular Formula | C33H52N2O4 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | 3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-phenylmethoxycarbonylpent-4-enoic acid |
| SMILES | C=CC(C1CC(C)(C)N(C)C(C)(C)C1)(C1CC(C)(C)N(C)C(C)(C)C1)C(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H52N2O4/c1-12-33(24-18-29(2,3)34(10)30(4,5)19-24,25-20-31(6,7)35(11)32(8,9)21-25)26(27(36)37)28(38)39-22-23-16-14-13-15-17-23/h12-17,24-26H,1,18-22H2,2-11H3,(H,36,37) |
| InChIKey | NNZRVYIXNUFIFP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|