C32H52N2O4 — CID 70530283
2-benzyl-2-[1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid (PubChem CID 70530283) has the molecular formula C32H52N2O4 and a molecular weight of 528.78 g/mol. Its IUPAC name is 2-benzyl-2-[1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid.
| Compound Name | 2-benzyl-2-[1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid |
|---|---|
| PubChem CID | 70530283 |
| Molecular Formula | C32H52N2O4 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.39 |
| IUPAC Name | 2-benzyl-2-[1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]propanedioic acid |
| SMILES | CCCC(C1CC(C)(C)NC(C)(C)C1)(C1CC(C)(C)NC(C)(C)C1)C(Cc1ccccc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C32H52N2O4/c1-10-16-31(23-18-27(2,3)33-28(4,5)19-23,24-20-29(6,7)34-30(8,9)21-24)32(25(35)36,26(37)38)17-22-14-12-11-13-15-22/h11-15,23-24,33-34H,10,16-21H2,1-9H3,(H,35,36)(H,37,38) |
| InChIKey | YASRLKURSUWXJT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|