C45H87NO — CID 70530285
2,2,6,6-tetramethyl-4-[(Z)-octadec-9-enoxy]-1-[(Z)-octadec-9-enyl]piperidine (PubChem CID 70530285) has the molecular formula C45H87NO and a molecular weight of 658.20 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[(Z)-octadec-9-enoxy]-1-[(Z)-octadec-9-enyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[(Z)-octadec-9-enoxy]-1-[(Z)-octadec-9-enyl]piperidine |
|---|---|
| PubChem CID | 70530285 |
| Molecular Formula | C45H87NO |
| Molecular Weight | 658.20 g/mol |
| Exact Mass | 657.68 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[(Z)-octadec-9-enoxy]-1-[(Z)-octadec-9-enyl]piperidine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC1CC(C)(C)N(CCCCCCCC/C=C\CCCCCCCC)C(C)(C)C1 |
| InChI | InChI=1S/C45H87NO/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-46-44(3,4)41-43(42-45(46,5)6)47-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24,43H,7-20,25-42H2,1-6H3/b23-21-,24-22- |
| InChIKey | KAKJTOUKQIMWIQ-SXAUZNKPSA-N |
| XLogP | 15.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.20 |
| LogP ≤ 5 | 15.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|